6645-46-1
| Name | L(-)-Carnitine hydrochloride |
| CAS | 6645-46-1 |
| EINECS(EC#) | 229-663-6 |
| Molecular Formula | C7H16ClNO3 |
| MDL Number | MFCD00066100 |
| Molecular Weight | 197.66 |
| MOL File | 6645-46-1.mol |
Chemical Properties
| Appearance | white to slightly beige crystalline powder |
| Melting point | 142 °C |
| alpha | -22 º (c=1, H2O) |
| storage temp. | −20°C |
| solubility | Water |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic |
| Optical Rotation | [α]/D -24.0±2.0°, c =0.2 in H2O |
| Water Solubility | soluble |
| Merck | 13,01862 |
| Stability: | Hygroscopic |
| Major Application | cell analysis |
| Cosmetics Ingredients Functions | SKIN CONDITIONING HUMECTANT |
| InChI | InChI=1S/C7H15NO3.ClH/c1-8(2,3)5-6(9)4-7(10)11;/h6,9H,4-5H2,1-3H3;1H |
| InChIKey | JXXCENBLGFBQJM-FYZOBXCZSA-N |
| SMILES | OC(C[N+](C)(C)C)CC(=O)[O-].[H]Cl |
| LogP | -4.518 (est) |
| CAS DataBase Reference | 6645-46-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | BP2979100 |
| REACH Registrations | Active |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |