653-34-9
| Name | 2,3,4,5,6-PENTAFLUOROSTYRENE |
| CAS | 653-34-9 |
| EINECS(EC#) | 211-500-5 |
| Molecular Formula | C8H3F5 |
| MDL Number | MFCD00000300 |
| Molecular Weight | 194.1 |
| MOL File | 653-34-9.mol |
Chemical Properties
| Appearance | colourless liquid |
| Boiling point | 62-63 °C/50 mmHg (lit.) |
| density | 1.406 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 94 °F |
| storage temp. | −20°C |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.432 |
| Stability: | Flammable. Incompatible with strong oxidizing agents. |
| Water Solubility | Immiscible with water. |
| BRN | 1874390 |
| InChI | InChI=1S/C8H3F5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
| InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| SMILES | C1(C=C)=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 653-34-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| Hazard Codes | F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Keep Cold |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |