63393-96-4
| Name | ADOGEN(R) 464 |
| CAS | 63393-96-4 |
| EINECS(EC#) | 264-120-7 |
| Molecular Formula | CH3N[(CH2)7CH3]3Cl |
| MDL Number | MFCD00132827 |
| Molecular Weight | 404.156 |
| MOL File | 63393-96-4.mol |
Chemical Properties
| Appearance | Viscous liquid |
| Boiling point | >240℃ |
| density | 0.898 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 33 mm Hg ( 20 °C) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with benzene and chloroform. |
| form | Viscous Liquid |
| color | Amber |
| Water Solubility | 1.023g/L at 20℃ |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C25H54N.ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;/h5-25H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XKBGEWXEAPTVCK-UHFFFAOYSA-M |
| SMILES | [N+](C)(CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Cl-] |
| LogP | 2.93 at 25℃ |
| EPA Substance Registry System | Quaternary ammonium compounds, tri-C8-10-alkylmethyl, chlorides (63393-96-4) |
Safety Data
| Symbol(GHS) |    GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H400-H301-H315-H318-H410 |
| Precautionary statements | P280a-P301+P310a-P321-P405-P501a-P273-P280-P301+P310-P305+P351+P338-P501 |
| Hazard Codes | C,N,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2924 3/PG 3 |
| WGK Germany | 3 |
| RTECS | UZ2997500 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1C - Combustible, acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Repr. 1B Skin Corr. 1C STOT RE 2 Oral |
| Toxicity |