619-57-8
| Name | 4-Hydroxybenzamide |
| CAS | 619-57-8 |
| EINECS(EC#) | 210-602-7 |
| Molecular Formula | C7H7NO2 |
| MDL Number | MFCD00007997 |
| Molecular Weight | 137.14 |
| MOL File | 619-57-8.mol |
Chemical Properties
| Appearance | White to off-white crystalline powder |
| Melting point | 161-162 °C (lit.) |
| Boiling point | 345.3±25.0 °C(Predicted) |
| density | 1.286±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 8.60±0.13(Predicted) |
| color | White to Light yellow to Dark green |
| BRN | 1906921 |
| InChI | InChI=1S/C7H7NO2/c8-7(10)5-1-3-6(9)4-2-5/h1-4,9H,(H2,8,10) |
| InChIKey | QXSAKPUBHTZHKW-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC=C(O)C=C1 |
| CAS DataBase Reference | 619-57-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |