579-39-5
| Name | 4,4'-DIFLUOROBENZIL |
| CAS | 579-39-5 |
| Molecular Formula | C14H8F2O2 |
| MDL Number | MFCD00134541 |
| Molecular Weight | 246.21 |
| MOL File | 579-39-5.mol |
Chemical Properties
| Appearance | pale yellow powder |
| Melting point | 120-122 °C (lit.) |
| Boiling point | 370.2±27.0 °C(Predicted) |
| density | 1.3163 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| Water Solubility | Soluble in water. |
| BRN | 1971736 |
| InChI | InChI=1S/C14H8F2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H |
| InChIKey | BRKULQOUSCHDGS-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)(=O)C(C1=CC=C(F)C=C1)=O |
| CAS DataBase Reference | 579-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanedione, bis(4-fluorophenyl)- (579-39-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | T |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |