
5750-76-5
| Name | 2,4,5-Trichloropyrimidine |
| CAS | 5750-76-5 |
| EINECS(EC#) | 628-281-0 |
| Molecular Formula | C4HCl3N2 |
| MDL Number | MFCD03788200 |
| Molecular Weight | 183.42 |
| MOL File | 5750-76-5.mol |
Chemical Properties
| Appearance | Colorless to pale yellow liquid |
| Boiling point | 84°C 1mm |
| density | 1.6001 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | clear liquid |
| pka | -4.26±0.29(Predicted) |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 4449 |
| InChI | InChI=1S/C4HCl3N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | GIKMWFAAEIACRF-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C(Cl)=N1 |
| CAS DataBase Reference | 5750-76-5(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3267 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
