
55453-87-7
| Name | Isoxepac |
| CAS | 55453-87-7 |
| EINECS(EC#) | 611-268-9 |
| Molecular Formula | C16H12O4 |
| MDL Number | MFCD00242952 |
| Molecular Weight | 268.26 |
| MOL File | 55453-87-7.mol |
Chemical Properties
| Melting point | 130-132°C |
| Boiling point | 528.2±50.0 °C(Predicted) |
| density | 1.39 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | neat |
| pka | 4.24±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Merck | 14,5237 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C16H12O4/c17-15(18)8-10-5-6-14-13(7-10)16(19)12-4-2-1-3-11(12)9-20-14/h1-7H,8-9H2,(H,17,18) |
| InChIKey | QFGMXJOBTNZHEL-UHFFFAOYSA-N |
| SMILES | O1CC2=CC=CC=C2C(=O)C2=CC(CC(O)=O)=CC=C12 |
| CAS DataBase Reference | 55453-87-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P405 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| RTECS | HQ4110000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2932996560 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 2 STOT RE 1 |
| Toxicity |
