
54-20-6
| Name | Trifluorothymine |
| CAS | 54-20-6 |
| EINECS(EC#) | 200-197-5 |
| Molecular Formula | C5H3F3N2O2 |
| MDL Number | MFCD00006024 |
| Molecular Weight | 180.08 |
| MOL File | 54-20-6.mol |
Chemical Properties
| Appearance | White to faintly yellow crystalline powder |
| Melting point | 245-246 °C(lit.) |
| density | 1.5484 (estimate) |
| storage temp. | −20°C |
| solubility | methanol: soluble50mg/mL, clear |
| form | powder to crystal |
| pka | 6.63±0.10(Predicted) |
| color | White to Orange to Green |
| Water Solubility | INSOLUBLE |
| BRN | 612694 |
| InChI | InChI=1S/C5H3F3N2O2/c6-5(7,8)2-1-9-4(12)10-3(2)11/h1H,(H2,9,10,11,12) |
| InChIKey | LMNPKIOZMGYQIU-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(C(F)(F)F)C(=O)N1 |
| CAS DataBase Reference | 54-20-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4(1H,3h)-pyrimidinedione, 5-(trifluoromethyl)-(54-20-6) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | YR1750000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
