538-81-8
| Name | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE |
| CAS | 538-81-8 |
| EINECS(EC#) | 212-952-6 |
| Molecular Formula | C16H14 |
| MDL Number | MFCD00004791 |
| Molecular Weight | 206.28 |
| MOL File | 538-81-8.mol |
Chemical Properties
| Appearance | light yellow crystalline powder |
| Melting point | 150-152 °C(lit.) |
| Boiling point | 350 °C(lit.) |
| density | 1.151 g/cm3 |
| refractive index | 1.5000 (estimate) |
| Fp | 350°C/720mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to slightly yellow |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | Slightly soluble in water. |
| Merck | 14,3320 |
| BRN | 1905937 |
| InChI | InChI=1S/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+ |
| InChIKey | JFLKFZNIIQFQBS-FNCQTZNRSA-N |
| SMILES | C(/C1=CC=CC=C1)=C\C=C\C1=CC=CC=C1 |
| CAS DataBase Reference | 538-81-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | Yes |
| HS Code | 29029000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |