
5306-98-9
| Name | 5-Chloro-2-methylphenol |
| CAS | 5306-98-9 |
| EINECS(EC#) | 226-160-3 |
| Molecular Formula | C7H7ClO |
| MDL Number | MFCD00060672 |
| Molecular Weight | 142.58 |
| MOL File | 5306-98-9.mol |
Chemical Properties
| Melting point | 72-76 °C (lit.) |
| Boiling point | 109-112°C 15mm |
| density | 1.1104 (rough estimate) |
| refractive index | 1.4443 (estimate) |
| Fp | 109-112°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 9.35±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1906683 |
| InChI | InChI=1S/C7H7ClO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3 |
| InChIKey | KKFPXGXMSBBNJI-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Cl)=CC=C1C |
| CAS DataBase Reference | 5306-98-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 5-chloro-2-methyl-(5306-98-9) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3437 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29081990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
