52225-20-4
| Name | DL-ALPHA-TOCOPHEROL ACETATE |
| CAS | 52225-20-4 |
| EINECS(EC#) | 231-710-0 |
| Molecular Formula | C31H52O3 |
| MDL Number | MFCD00072042 |
| Molecular Weight | 472.74 |
| MOL File | 52225-20-4.mol |
Chemical Properties
| Appearance | clear light yellow to light green viscous liquid |
| Melting point | -27.5° |
| Boiling point | bp0.01 184°; bp0.025 194°; bp0.3 224° |
| density | 0.96 g/mL at 20 °C(lit.) |
| refractive index | n |
| Fp | 9℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethanol (Sparingly), Methanol (Sparingly) |
| form | Viscous Liquid |
| color | Clear light yellow to light green |
| Stability: | Light Sensitive |
| Major Application | clinical testing clinical testing |
| InChI | InChI=1/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/s3 |
| InChIKey | ZAKOWWREFLAJOT-FDQWOHIBNA-N |
| SMILES | [C@@]1(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)OC2=C(C)C(C)=C(OC(=O)C)C(C)=C2CC1 |&1:0,5,10,r| |
| CAS DataBase Reference | 52225-20-4(CAS DataBase Reference) |
| EPA Substance Registry System | DL-Vitamin E acetate (52225-20-4) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P305+P351+P338 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 1 |
| RTECS | GA8747000 |
| F | 8-10-23 |
| HS Code | 29362800 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |