51-44-5
| Name | 3,4-Dichlorobenzoic acid |
| CAS | 51-44-5 |
| EINECS(EC#) | 200-099-2 |
| Molecular Formula | C7H4Cl2O2 |
| MDL Number | MFCD00002492 |
| Molecular Weight | 191.01 |
| MOL File | 51-44-5.mol |
Chemical Properties
| Appearance | White to light yellow crystal powder |
| Melting point | 204-206 °C (lit.) |
| Boiling point | 273.68°C (rough estimate) |
| density | 1.4410 (rough estimate) |
| refractive index | 1.4590 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.60±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | insoluble |
| BRN | 2044777 |
| InChI | InChI=1S/C7H4Cl2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | VPHHJAOJUJHJKD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C(Cl)=C1 |
| CAS DataBase Reference | 51-44-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 3,4-dichloro-(51-44-5) |
| EPA Substance Registry System | 51-44-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DG7175000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Safety Profile |