50820-65-0
| Name | Methyl indole-6-carboxylate |
| CAS | 50820-65-0 |
| EINECS(EC#) | 610-576-0 |
| Molecular Formula | C10H9NO2 |
| MDL Number | MFCD00211063 |
| Molecular Weight | 175.18 |
| MOL File | 50820-65-0.mol |
Chemical Properties
| Appearance | Off-white crystalline powder |
| Melting point | 76-80 °C (lit.) |
| Boiling point | 331.7±15.0 °C(Predicted) |
| density | 1.253±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Powder or Crystalline Powder |
| pka | 15.80±0.30(Predicted) |
| color | White to pale brown |
| Usage | An indole compound for treating pain, inflammation and other conditions. |
| BRN | 141837 |
| InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-3-2-7-4-5-11-9(7)6-8/h2-6,11H,1H3 |
| InChIKey | AYYOZKHMSABVRP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(OC)=O)=C2)C=C1 |
| CAS DataBase Reference | 50820-65-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |