
50607-30-2
| Name | 2,4-Piperadinedione |
| CAS | 50607-30-2 |
| EINECS(EC#) | 803-771-9 |
| Molecular Formula | C5H7NO2 |
| MDL Number | MFCD08704814 |
| Molecular Weight | 113.11 |
| MOL File | 50607-30-2.mol |
Chemical Properties
| Melting point | 98.0 to 102.0 °C |
| Boiling point | 362.1±35.0 °C(Predicted) |
| density | 1.184±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 12.00±0.70(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C5H7NO2/c7-4-1-2-6-5(8)3-4/h1-3H2,(H,6,8) |
| InChIKey | RDNZDMDLRIQQAX-UHFFFAOYSA-N |
| SMILES | N1CCC(=O)CC1=O |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 2933790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
