4916-57-8
| Name | 1,2-BIS(4-PYRIDYL)ETHANE |
| CAS | 4916-57-8 |
| EINECS(EC#) | 225-543-2 |
| Molecular Formula | C12H12N2 |
| MDL Number | MFCD00006451 |
| Molecular Weight | 184.24 |
| MOL File | 4916-57-8.mol |
Chemical Properties
| Appearance | white to light yellow crystals or cryst. powder |
| Melting point | 110-112 °C(lit.) |
| Boiling point | 174 °C / 3mmHg |
| density | 1.1160 (rough estimate) |
| refractive index | 1.6266 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystals or Crystalline Powder |
| pka | 6.13±0.10(Predicted) |
| color | White to light yellow or pinkish |
| InChI | InChI=1S/C12H12N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H,1-2H2 |
| InChIKey | DQRKTVIJNCVZAX-UHFFFAOYSA-N |
| SMILES | C(C1C=CN=CC=1)CC1C=CN=CC=1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
