447440-43-9
| Name | (s,s)-2-ALLYL-2-CHLORO-3,4-DIMETHYL-5-PHENYL-[1,3,2]-OXAZASILOLIDINE |
| CAS | 447440-43-9 |
| Molecular Formula | C13H18ClNOSi |
| MDL Number | MFCD09953823 |
| Molecular Weight | 267.83 |
| MOL File | 447440-43-9.mol |
Chemical Properties
| density | 1.095 g/mL at 25 °C |
| refractive index | n20/D1.517 |
| Fp | 38℃ |
| form | liquid |
| pka | 4.43±0.60(Predicted) |
| Specific Gravity | 1.01 |
| Optical Rotation | [α]20/D 72.5°, c = 0.6 in ethanol (200 proof) |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive, store cold |
| Boiling point | 120°C/5 mmHg |
| InChI | 1S/C13H18ClNOSi/c1-4-10-17(14)15(3)11(2)13(16-17)12-8-6-5-7-9-12/h4-9,11,13H,1,10H2,2-3H3/t11-,13+,17?/m0/s1 |
| InChIKey | XHCRAANIMMYPDV-APBZJUGRSA-N |
| SMILES | C[C@H]1[C@@H](O[Si](Cl)(CC=C)N1C)c2ccccc2 |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H261-H315-H319-H335 |
| Precautionary statements | P231+P232-P261-P305+P351+P338-P422 |
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3132 / PGII |
| WGK Germany | 3 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 Water-react 2 |
;