
4341-24-6
| Name | 5-METHYLCYCLOHEXANE-1,3-DIONE |
| CAS | 4341-24-6 |
| Molecular Formula | C7H10O2 |
| MDL Number | MFCD00010379 |
| Molecular Weight | 126.15 |
| MOL File | 4341-24-6.mol |
Chemical Properties
| Appearance | White to beige crystals or powder |
| Melting point | 126-130 °C(lit.) |
| Boiling point | 194.28°C (rough estimate) |
| density | 1.0579 (rough estimate) |
| refractive index | 1.4660 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 5.29±0.20(Predicted) |
| color | Tan to Light Brown |
| BRN | 1099692 |
| InChI | InChI=1S/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h5H,2-4H2,1H3 |
| InChIKey | DMIIMPQQPXUKOO-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)CC(=O)C1 |
| CAS DataBase Reference | 4341-24-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HS Code | 29142990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
