
433939-27-6
| Name | 3-Fluoro-5-bromophenol |
| CAS | 433939-27-6 |
| EINECS(EC#) | 627-426-5 |
| Molecular Formula | C6H4BrFO |
| MDL Number | MFCD07783710 |
| Molecular Weight | 191 |
| MOL File | 433939-27-6.mol |
Chemical Properties
| Melting point | 42 °C |
| Boiling point | 52-55 °C(Press: 9.98e-2 Torr) |
| density | 1.764±0.06 g/cm3(Predicted) |
| Fp | 110 °C |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 8.01±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H4BrFO/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| InChIKey | JCPJGUPQZDEZQH-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC(Br)=C1 |
| CAS DataBase Reference | 433939-27-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |