
4199-10-4
| Name | (S)-(-)-PROPRANOLOL HYDROCHLORIDE |
| CAS | 4199-10-4 |
| EINECS(EC#) | 224-096-0 |
| Molecular Formula | C16H22ClNO2 |
| MDL Number | MFCD00064547 |
| Molecular Weight | 295.8 |
| MOL File | 4199-10-4.mol |
Chemical Properties
| Melting point | 193-195 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | ethanol: 10 mg/mL |
| form | powder |
| color | White to off-white |
| Optical Rotation | [α]25/D 25.5°, c = 1.0 in ethanol(lit.) |
| Water Solubility | Soluble to 100 mM in water |
| BRN | 3574966 |
| InChI | 1S/C16H21NO2.ClH/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;/h3-9,12,14,17-18H,10-11H2,1-2H3;1H/t14-;/m0./s1 |
| InChIKey | ZMRUPTIKESYGQW-UQKRIMTDSA-N |
| SMILES | Cl[H].CC(C)NC[C@H](O)COc1cccc2ccccc12 |
| CAS DataBase Reference | 4199-10-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
