
4175-78-4
| Name | 2,5-DIBROMOTHIAZOLE |
| CAS | 4175-78-4 |
| EINECS(EC#) | 628-983-7 |
| Molecular Formula | C3HBr2NS |
| MDL Number | MFCD00016891 |
| Molecular Weight | 242.92 |
| MOL File | 4175-78-4.mol |
Chemical Properties
| Appearance | White to brown crystalline powder |
| Melting point | 45-49 °C (lit.) |
| Boiling point | 242.8±13.0 °C(Predicted) |
| density | 2.324±0.06 g/cm3(Predicted) |
| Fp | 110 °C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | -0.88±0.10(Predicted) |
| color | White to brown |
| InChI | InChI=1S/C3HBr2NS/c4-2-1-6-3(5)7-2/h1H |
| InChIKey | XIBIQFJKUZZLLX-UHFFFAOYSA-N |
| SMILES | S1C(Br)=CN=C1Br |
| CAS DataBase Reference | 4175-78-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
