41051-80-3
| Name | (N,N-Diethyl-3-aminopropyl)trimethoxysilane |
| CAS | 41051-80-3 |
| EINECS(EC#) | 255-192-0 |
| Molecular Formula | C10H25NO3Si |
| MDL Number | MFCD00039882 |
| Molecular Weight | 235.4 |
| MOL File | 41051-80-3.mol |
Chemical Properties
| Appearance | Yellowish clear liquid with amine odor |
| Boiling point | 120 °C/20 mmHg (lit.) |
| density | 0.95 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 212 °F |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 10.56±0.25(Predicted) |
| color | Colorless to Yellow |
| Specific Gravity | 0.934 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C10H25NO3Si/c1-6-11(7-2)9-8-10-15(12-3,13-4)14-5/h6-10H2,1-5H3 |
| InChIKey | ZLDHYRXZZNDOKU-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)CC[Si](OC)(OC)OC |
| CAS DataBase Reference | 41051-80-3(CAS DataBase Reference) |
| EPA Substance Registry System | 41051-80-3(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |