
4023-02-3
| Name | 1H-Pyrazole-1-carboxamidine hydrochloride |
| CAS | 4023-02-3 |
| EINECS(EC#) | 429-520-1 |
| Molecular Formula | C4H7ClN4 |
| MDL Number | MFCD00210087 |
| Molecular Weight | 146.58 |
| MOL File | 4023-02-3.mol |
Chemical Properties
| Appearance | white to light yellow crystals or crystalline |
| Melting point | 167-170 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to light yellow |
| Water Solubility | Soluble |
| Usage | A stable and versatile reagent for the efficient and chemically specific guanylation of sterically unhindered primary and secondary aliphatic amines under mild conditions. Useful reagent in peptide synthesis |
| BRN | 5448758 |
| InChI | InChI=1S/C4H6N4.ClH/c5-4(6)8-3-1-2-7-8;/h1-3H,(H3,5,6);1H |
| InChIKey | RBZRMBCLZMEYEH-UHFFFAOYSA-N |
| SMILES | N1(C(N)=N)C=CC=N1.[H]Cl |
| CAS DataBase Reference | 4023-02-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H335-H373-H412 |
| Precautionary statements | P273-P280-P301+P312-P302+P352-P305+P351+P338-P314 |
| Hazard Codes | Xi,C |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| REACH Registrations | Inactive |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Sens. 1 STOT RE 2 |


