
402-54-0
| Name | 4-Nitrobenzotrifluoride |
| CAS | 402-54-0 |
| EINECS(EC#) | 206-948-3 |
| Molecular Formula | C7H4F3NO2 |
| MDL Number | MFCD00007358 |
| Molecular Weight | 191.11 |
| MOL File | 402-54-0.mol |
Chemical Properties
| Appearance | colorless to light yellow liqui |
| Melting point | 38-40 °C (lit.) |
| Boiling point | 81-83 °C/10 mmHg (lit.) |
| density | 1.3910 (estimate) |
| Fp | 191 °F |
| solubility | soluble in Methanol |
| form | Crystalline Powder, Crystals or Crystalline Mass |
| color | White to yellow |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents, strong reducing agents. |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | 1S/C7H4F3NO2/c8-7(9,10)5-1-3-6(4-2-5)11(12)13/h1-4H |
| InChIKey | XKYLCLMYQDFGKO-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 402-54-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitro-alpha,alpha,alpha-trifluorotoluene(402-54-0) |
| EPA Substance Registry System | 402-54-0(EPA Substance) |
Safety Data
| Hazard Codes | T+,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3431 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |