
39070-63-8
| Name | (3,4-Diaminophenyl)phenylmethanone |
| CAS | 39070-63-8 |
| EINECS(EC#) | 254-273-8 |
| Molecular Formula | C13H12N2O |
| MDL Number | MFCD00007727 |
| Molecular Weight | 212.25 |
| MOL File | 39070-63-8.mol |
Chemical Properties
| Appearance | yellow to ochre-yellow powder |
| Melting point | 115-117 °C (lit.) |
| Boiling point | 352.09°C (rough estimate) |
| density | 1.1128 (rough estimate) |
| refractive index | 1.6920 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 0.4g/l |
| form | Powder |
| pka | 2.96±0.10(Predicted) |
| color | Yellow to ochre-yellow |
| Water Solubility | 410 mg/L (20 ºC) |
| BRN | 2212487 |
| InChI | InChI=1S/C13H12N2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8H,14-15H2 |
| InChIKey | RXCOGDYOZQGGMK-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C(N)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 39070-63-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 9-23 |
| Autoignition Temperature | 550°C |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
