
387-44-0
| Name | 7-Fluoroindole |
| CAS | 387-44-0 |
| EINECS(EC#) | 640-248-2 |
| Molecular Formula | C8H6FN |
| MDL Number | MFCD01074502 |
| Molecular Weight | 135.14 |
| MOL File | 387-44-0.mol |
Chemical Properties
| Melting point | 61 °C |
| Boiling point | 258.0±13.0 °C(Predicted) |
| density | 1.273±0.06 g/cm3(Predicted) |
| Fp | >110° |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. (almost transparency) |
| form | powder to crystal |
| pka | 15.55±0.30(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 114740 |
| InChI | InChI=1S/C8H6FN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H |
| InChIKey | XONKJZDHGCMRRF-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2F)C=C1 |
| CAS DataBase Reference | 387-44-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

