38677-85-9
| Name | FLUNIXIN MEGLUMINE |
| CAS | 38677-85-9 |
| Molecular Formula | C21H28F3N3O7 |
| MDL Number | MFCD01725419 |
| Molecular Weight | 491.46 |
| MOL File | 38677-85-9.mol |
Chemical Properties
| Appearance | Crystalline Solid |
| Melting point | 136.6-137.4 °C |
| Boiling point | 378.7±42.0 °C(Predicted) |
| density | 1.403±0.06 g/cm3(Predicted) |
| solubility | H2O: freely soluble |
| form | solid |
| pka | 5.82(at 25℃) |
| color | off-white |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Usage | Cyclooxigenase inhibitor. Anti-inflammatory; analgesic; antipyretic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C14H11F3N2O2/c1-8-10(14(15,16)17)5-2-6-11(8)19-12-9(13(20)21)4-3-7-18-12/h2-7H,1H3,(H,18,19)(H,20,21) |
| InChIKey | NOOCSNJCXJYGPE-UHFFFAOYSA-N |
| SMILES | Cc1c(Nc2ncccc2C(O)=O)cccc1C(F)(F)F |
| CAS DataBase Reference | 38677-85-9(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Pyridinecarboxylic acid, 2-[[2-methyl-3-(trifluoromethyl)phenyl]amino]- (38677-85-9) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LZ4367000 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |