35794-11-7
| Name | 3,5-Dimethylpiperidine |
| CAS | 35794-11-7 |
| EINECS(EC#) | 252-730-6 |
| Molecular Formula | C7H15N |
| MDL Number | MFCD00005996 |
| Molecular Weight | 113.2 |
| MOL File | 35794-11-7.mol |
Chemical Properties
| Appearance | clear colorless to light yellow liquid |
| Boiling point | 144 °C(lit.) |
| density | 0.853 g/mL at 25 °C(lit.) |
| vapor pressure | 6.47hPa at 25℃ |
| refractive index | n |
| Fp | 91 °F |
| storage temp. | Flammables area |
| form | Liquid |
| pka | 10.52±0.10(Predicted) |
| color | Clear colorless to light yellow |
| Detection Methods | GC,NMR |
| BRN | 102638 |
| InChI | InChI=1S/C7H15N/c1-6-3-7(2)5-8-4-6/h6-8H,3-5H2,1-2H3 |
| InChIKey | IDWRJRPUIXRFRX-UHFFFAOYSA-N |
| SMILES | N1CC(C)CC(C)C1 |
| LogP | 2.02 |
| CAS DataBase Reference | 35794-11-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Piperidine, 3,5-dimethyl-(35794-11-7) |
| EPA Substance Registry System | 35794-11-7(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |