352439-08-8
| Name | 2,4,6-TRICHLOROANISOLE-D5 |
| CAS | 352439-08-8 |
| Molecular Formula | C7H5Cl3O |
| MDL Number | MFCD01074305 |
| Molecular Weight | 211.47 |
| MOL File | 352439-08-8.mol |
Chemical Properties
| Melting point | 60-62 °C(lit.) |
| Boiling point | 132 °C/28 mmHg(lit.) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | neat |
| color | White to off-white |
| Major Application | agriculture cleaning products cosmetics environmental flavors and fragrances food and beverages personal care |
| InChI | 1S/C7H5Cl3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3/i1D3,2D,3D |
| InChIKey | WCVOGSZTONGSQY-RHIBPKLGSA-N |
| SMILES | [2H]c1c(Cl)c([2H])c(Cl)c(OC([2H])([2H])[2H])c1Cl |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H413 |
| Precautionary statements | P273-P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 |