351-35-9
| Name | m-(Trifluoromethyl)phenylacetic acid |
| CAS | 351-35-9 |
| EINECS(EC#) | 206-511-7 |
| Molecular Formula | C9H7F3O2 |
| MDL Number | MFCD00004339 |
| Molecular Weight | 204.15 |
| MOL File | 351-35-9.mol |
Chemical Properties
| Appearance | white to pale yellow crystalline powder |
| Melting point | 76-79 °C(lit.) |
| Boiling point | 238C/775Torr |
| density | 1.357±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.14±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2213223 |
| InChI | InChI=1S/C9H7F3O2/c10-9(11,12)7-3-1-2-6(4-7)5-8(13)14/h1-4H,5H2,(H,13,14) |
| InChIKey | BLXXCCIBGGBDHI-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 351-35-9(CAS DataBase Reference) |
| EPA Substance Registry System | 351-35-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
