349-65-5
| Name | 2-Methoxy-5-(trifluoromethyl)aniline |
| CAS | 349-65-5 |
| EINECS(EC#) | 626-005-3 |
| Molecular Formula | C8H8F3NO |
| MDL Number | MFCD00042486 |
| Molecular Weight | 191.15 |
| MOL File | 349-65-5.mol |
Chemical Properties
| Appearance | Beige-greyish to brownish crystalline powder |
| Melting point | 58-60 °C (lit.) |
| Boiling point | 230.1±40.0 °C(Predicted) |
| density | 1.2645 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder |
| pka | 3.31±0.10(Predicted) |
| color | Beige-gray to brown |
| BRN | 2835713 |
| InChI | InChI=1S/C8H8F3NO/c1-13-7-3-2-5(4-6(7)12)8(9,10)11/h2-4H,12H2,1H3 |
| InChIKey | RKUSRLUGUVDNKP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C(F)(F)F)=CC=C1OC |
| CAS DataBase Reference | 349-65-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222990 |
