
347-54-6
| Name | 5-Fluorosalicylaldehyde |
| CAS | 347-54-6 |
| EINECS(EC#) | 626-267-9 |
| Molecular Formula | C7H5FO2 |
| MDL Number | MFCD01090997 |
| Molecular Weight | 140.11 |
| MOL File | 347-54-6.mol |
Chemical Properties
| Melting point | 82-85 °C (lit.) |
| Boiling point | 56 °C / 1mmHg |
| density | 1.350±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder or Flakes |
| pka | 8.18±0.18(Predicted) |
| color | White to Orange to Green |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C7H5FO2/c8-6-1-2-7(10)5(3-6)4-9/h1-4,10H |
| InChIKey | FDUBQNUDZOGOFE-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(F)=CC=C1O |
| CAS DataBase Reference | 347-54-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
