| Appearance |
Slightly Off-White Crystalline Solid |
| Melting point |
210-212 °C |
| alpha |
-14～-18°(D/20℃) (c=0,H2O) |
| Boiling point |
477.77°C (rough estimate) |
| density |
1.3038 (rough estimate) |
| refractive index |
1.5110 (estimate) |
| storage temp. |
−20°C
|
| solubility |
H2O: 5 mg/mL, clear, colorless to very faintly yellow
|
| form |
Fine Powder |
| pka |
12.76±0.70(Predicted) |
| color |
White to off-white |
| Water Solubility |
water: 5mg/mL, clear, colorless to very faintly yellow |
| Usage |
Useful substrate for the rapid colorimetric assay of N-Acetyl-beta-glucosaminidase in human urine |
| λmax |
400nm(Phosphate buffer sol.)(lit.) |
| BRN |
96193 |
| InChI |
InChI=1/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14-/s3 |
| InChIKey |
OMRLTNCLYHKQCK-DOSMMQPLNA-N |
| SMILES |
O(C1C=CC(N(=O)=O)=CC=1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)C |&1:10,12,15,17,19,r| |
| CAS DataBase Reference |
3459-18-5(CAS DataBase Reference) |
