328-74-5
| Name | 3,5-Di(trifluoromethyl)aniline |
| CAS | 328-74-5 |
| EINECS(EC#) | 206-335-0 |
| Molecular Formula | C8H5F6N |
| MDL Number | MFCD00000394 |
| Molecular Weight | 229.12 |
| MOL File | 328-74-5.mol |
Chemical Properties
| Appearance | clear light yellow to yellow-brown liquid |
| Melting point | 168.2-169.2 °C |
| Boiling point | 85 °C15 mm Hg(lit.) |
| density | 1.467 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 182 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 2.15±0.10(Predicted) |
| color | Clear light yellow to yellow-brown |
| Specific Gravity | 1.473 |
| Water Solubility | Not miscible in water. |
| BRN | 654318 |
| InChI | 1S/C8H5F6N/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-3H,15H2 |
| InChIKey | CDIDGWDGQGVCIB-UHFFFAOYSA-N |
| SMILES | Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 328-74-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 3,5-bis(trifluoromethyl)-(328-74-5) |
| EPA Substance Registry System | 328-74-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | ZE9800000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214910 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
