
31643-49-9
| Name | 5-Nitrobenzene-1,2-dicarbonitrile |
| CAS | 31643-49-9 |
| EINECS(EC#) | 250-748-9 |
| Molecular Formula | C8H3N3O2 |
| MDL Number | MFCD00040301 |
| Molecular Weight | 173.13 |
| MOL File | 31643-49-9.mol |
Chemical Properties
| Appearance | light yellow, light greenish or light grey to |
| Melting point | 142-144 °C(lit.) |
| Boiling point | 303.75°C (rough estimate) |
| density | 1.4553 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | Light yellow, light greenish or light gray to beige |
| Water Solubility | Sparingly soluble in water.(0.26 g/L) (25°C), |
| BRN | 1877554 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C8H3N3O2/c9-4-6-1-2-8(11(12)13)3-7(6)5-10/h1-3H |
| InChIKey | NTZMSBAAHBICLE-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC=C([N+]([O-])=O)C=C1C#N |
| CAS DataBase Reference | 31643-49-9(CAS DataBase Reference) |
| EPA Substance Registry System | 31643-49-9(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | TI8576000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
