31098-20-1
| Name | Potassium 3-sulphonatopropyl acrylate |
| CAS | 31098-20-1 |
| EINECS(EC#) | 250-465-0 |
| Molecular Formula | C6H9KO5S |
| MDL Number | MFCD00010138 |
| Molecular Weight | 232.3 |
| MOL File | 31098-20-1.mol |
Chemical Properties
| Melting point | 302°C (dec.) |
| vapor pressure | 0.01Pa at 20℃ |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | 1S/C6H10O5S.K/c1-2-6(7)11-4-3-5-12(8,9)10;/h2H,1,3-5H2,(H,8,9,10);/q;+1/p-1 |
| InChIKey | VSFOXJWBPGONDR-UHFFFAOYSA-M |
| SMILES | [K+].[O-]S(=O)(=O)CCCOC(=O)C=C |
| LogP | -3.63 at 21.5℃ |
| EPA Substance Registry System | 2-Propenoic acid, 3-sulfopropyl ester, potassium salt(31098-20-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 3504009000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| DEA Controlled Substances | CSCN: 1635 CAS SCH: IV NARC: N |