
2892-62-8
| Name | Dibutyl squarate |
| CAS | 2892-62-8 |
| EINECS(EC#) | -0 |
| Molecular Formula | C12H18O4 |
| MDL Number | MFCD00037150 |
| Molecular Weight | 226.27 |
| MOL File | 2892-62-8.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Boiling point | 139 °C0.5 mm Hg(lit.) |
| density | 1.047 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | INSOLUBLE |
| BRN | 1968189 |
| InChI | InChI=1S/C12H18O4/c1-3-5-7-15-11-9(13)10(14)12(11)16-8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | XBRWELTXMQSEIN-UHFFFAOYSA-N |
| SMILES | C1(=O)C(OCCCC)=C(OCCCC)C1=O |
| CAS DataBase Reference | 2892-62-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Dibutyl squarate(2892-62-8) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | GU1772066 |
| HS Code | 29145090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
