2863-98-1
| Name | 4-Cyanophenylhydrazine hydrochloride |
| CAS | 2863-98-1 |
| EINECS(EC#) | 608-230-9 |
| Molecular Formula | C7H8ClN3 |
| MDL Number | MFCD00673994 |
| Molecular Weight | 169.61 |
| MOL File | 2863-98-1.mol |
Chemical Properties
| Appearance | Pale orange to brown powder |
| Melting point | 241-244 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | Powder |
| color | Pale orange to brown |
| Sensitive | Moisture Sensitive |
| BRN | 3565486 |
| InChI | InChI=1S/C7H7N3.ClH/c8-5-6-1-3-7(10-9)4-2-6;/h1-4,10H,9H2;1H |
| InChIKey | UXDLLFIRCVPPQP-UHFFFAOYSA-N |
| SMILES | C1(C#N)=CC=C(NN)C=C1.Cl |
| CAS DataBase Reference | 2863-98-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
