2834-23-3
| Name | CHLORODIFLUOROACETIC ANHYDRIDE |
| CAS | 2834-23-3 |
| EINECS(EC#) | 220-603-4 |
| Molecular Formula | C4Cl2F4O3 |
| MDL Number | MFCD00000774 |
| Molecular Weight | 242.94 |
| MOL File | 2834-23-3.mol |
Chemical Properties
| Boiling point | 96-97 °C (lit.) |
| density | 1.395 |
| refractive index | 1.347 |
| Fp | None |
| storage temp. | RT, protect from light, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.395 |
| Water Solubility | Slightly Soluble in water. (1.4 g/L) (25°C) |
| Sensitive | Lachrymatory |
| BRN | 1912832 |
| InChI | InChI=1S/C4Cl2F4O3/c5-3(7,8)1(11)13-2(12)4(6,9)10 |
| InChIKey | VBJIFLOSOQGDRZ-UHFFFAOYSA-N |
| SMILES | O(C(=O)C(F)(F)Cl)C(=O)C(F)(F)Cl |
| CAS DataBase Reference | 2834-23-3(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, chlorodifluoro-, anhydride (2834-23-3) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H314 |
| Precautionary statements | P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P362+P364 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | T |
| REACH Registrations | Inactive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2915907098 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Eye Dam. 1 Skin Corr. 1B |
