
28314-80-9
| Name | 2,4,6-Trifluorobenzoic acid |
| CAS | 28314-80-9 |
| EINECS(EC#) | 220-603-4 |
| Molecular Formula | C7H3F3O2 |
| MDL Number | MFCD00042398 |
| Molecular Weight | 176.09 |
| MOL File | 28314-80-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 142-145 °C (lit.) |
| Boiling point | 218.2±35.0 °C(Predicted) |
| density | 1.4362 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.28±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 1958300 |
| InChI | InChI=1S/C7H3F3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
| InChIKey | SJZATRRXUILGHH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=C(F)C=C1F |
| CAS DataBase Reference | 28314-80-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
