
28210-41-5
| Name | POLYSTYRENE SULFONIC ACID |
| CAS | 28210-41-5 |
| EINECS(EC#) | 411-200-6 |
| Molecular Formula | (C8H8O3S)x |
| MDL Number | MFCD00165973 |
| Molecular Weight | 184.21 |
| MOL File | 28210-41-5.mol |
Chemical Properties
| Melting point | 1°C |
| Boiling point | 100°C |
| density | 1.11 g/mL at 25 °C |
| refractive index | n |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: soluble |
| form | Liquid |
| color | Amber |
| PH | 1.55 (25℃) |
| Water Solubility | Miscible with water, ethanol, methanol, lower alcohols and glycols. |
| Exposure limits | ACGIH: TWA 0.2 mg/m3 OSHA: TWA 1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 1 mg/m3 |
| InChI | InChI=1S/C8H8O3S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h2-6H,1H2,(H,9,10,11) |
| InChIKey | MAGFQRLKWCCTQJ-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(C=C)=CC=1)(O)(=O)=O |
| EPA Substance Registry System | Benzenesulfonic acid, 4-ethenyl-, homopolymer (28210-41-5) |
Safety Data
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P405-P501a-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2586 8/PG 3 |
| WGK Germany | - |
| TSCA | Yes |
| HazardClass | 8 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Dam. 1 Skin Corr. 1A |
