27318-90-7
| Name | 1 10-PHENANTHROLINE-5 6-DIONE 97 |
| CAS | 27318-90-7 |
| Molecular Formula | C12H6N2O2 |
| MDL Number | MFCD00014473 |
| Molecular Weight | 210.19 |
| MOL File | 27318-90-7.mol |
Chemical Properties
| Melting point | 260 °C (dec.)(lit.) |
| Boiling point | 456.1±20.0 °C(Predicted) |
| density | 1.444±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 0.26±0.20(Predicted) |
| color | Light yellow to Amber to Dark green |
| Water Solubility | Insoluble in water. |
| λmax | 251nm(MeOH)(lit.) |
| InChI | InChI=1S/C12H6N2O2/c15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10/h1-6H |
| InChIKey | KCALAFIVPCAXJI-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(=O)C(=O)C3=C2N=CC=C3)C=CC=1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
