
26159-35-3
| Name | (S)-α-Methyl-6-methoxy-2-naphthaleneacetic acid methyl ester |
| CAS | 26159-35-3 |
| Molecular Formula | C15H16O3 |
| MDL Number | MFCD12031841 |
| Molecular Weight | 244.29 |
| MOL File | 26159-35-3.mol |
Chemical Properties
| Melting point | 87 °C |
| Boiling point | 358.7±17.0 °C(Predicted) |
| density | 1.122±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Optical Rotation | [α]/D 72.0 to 84.0°, c =0.1 in chloroform |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C15H16O3/c1-10(15(16)18-3)11-4-5-13-9-14(17-2)7-6-12(13)8-11/h4-10H,1-3H3/t10-/m0/s1 |
| InChIKey | ZFYFBPCRUQZGJE-JTQLQIEISA-N |
| SMILES | C[C@H](C(OC)=O)C1=CC2=CC=C(OC)C=C2C=C1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |
