2557-78-0
| Name | 2-FLUOROTHIOPHENOL |
| CAS | 2557-78-0 |
| EINECS(EC#) | 202-710-8 |
| Molecular Formula | C6H5FS |
| MDL Number | MFCD00041419 |
| Molecular Weight | 128.17 |
| MOL File | 2557-78-0.mol |
Chemical Properties
| Appearance | clear colorless to light yellow liquid |
| Boiling point | 61-62 °C/35 mmHg (lit.) |
| density | 1.2 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 118 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| pka | 6.00±0.43(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.20 |
| Sensitive | Stench |
| BRN | 2039768 |
| InChI | 1S/C6H5FS/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| InChIKey | WJTZZPVVTSDNJJ-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1S |
| CAS DataBase Reference | 2557-78-0(CAS DataBase Reference) |
| NIST Chemistry Reference | O-fluorothiophenol(2557-78-0) |
Safety Data
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Stench |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |