24801-88-5
| Name | 3-Isocyanatopropyltriethoxysilane |
| CAS | 24801-88-5 |
| EINECS(EC#) | 246-467-6 |
| Molecular Formula | C10H21NO4Si |
| MDL Number | MFCD00051459 |
| Molecular Weight | 247.36 |
| MOL File | 24801-88-5.mol |
Chemical Properties
| Appearance | Colorless clear liquid |
| Melting point | <0°C |
| Boiling point | 283 °C(lit.) |
| density | 0.999 g/mL at 25 °C(lit.) |
| vapor pressure | 0-7910Pa at 20-25℃ |
| refractive index | n |
| Fp | 171 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 0.999 |
| Water Solubility | Hydrolyzes in water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 4404652 |
| InChI | 1S/C10H21NO4Si/c1-4-13-16(14-5-2,15-6-3)9-7-8-11-10-12/h4-9H2,1-3H3 |
| InChIKey | FRGPKMWIYVTFIQ-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC |
| LogP | -4--0.3 at 20℃ |
Safety Data
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312-H314-H317-H330-H334 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3390 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | VV6691000 |
| F | 10-19-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |
| Toxicity |