239087-08-2
| Name | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYL BROMIDE |
| CAS | 239087-08-2 |
| EINECS(EC#) | 627-330-3 |
| Molecular Formula | C8H5BrF4 |
| MDL Number | MFCD00082477 |
| Molecular Weight | 257.02 |
| MOL File | 239087-08-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 38-42 °C (lit.) |
| Boiling point | 186℃ |
| density | 1.640 |
| Fp | 225 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C8H5BrF4/c9-4-5-6(8(11,12)13)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | RINUERVPFANASB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C(F)(F)F)=C1CBr |
| CAS DataBase Reference | 239087-08-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |