23814-12-2
| Name | Benzotriazole-5-carboxylic acid |
| CAS | 23814-12-2 |
| EINECS(EC#) | 627-916-9 |
| Molecular Formula | C7H5N3O2 |
| MDL Number | MFCD00012318 |
| Molecular Weight | 163.13 |
| MOL File | 23814-12-2.mol |
Chemical Properties
| Melting point | 305 °C |
| Boiling point | 0°C |
| density | 1.617±0.06 g/cm3(Predicted) |
| Fp | 0°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | slightly sol. in Dimethylformamide |
| form | powder to crystal |
| pka | 3.47±0.30(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C7H5N3O2/c11-7(12)4-1-2-5-6(3-4)9-10-8-5/h1-3H,(H,11,12)(H,8,9,10) |
| InChIKey | GUOVBFFLXKJFEE-UHFFFAOYSA-N |
| SMILES | N1C2=CC(C(O)=O)=CC=C2N=N1 |
| CAS DataBase Reference | 23814-12-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |