22677-21-0
| Name | (R)-(+)-4-HYDROXY-2-PYRROLIDINONE |
| CAS | 22677-21-0 |
| Molecular Formula | C4H7NO2 |
| MDL Number | MFCD00273364 |
| Molecular Weight | 101.1 |
| MOL File | 22677-21-0.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 156-160 °C |
| Boiling point | 363.6±35.0 °C(Predicted) |
| density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly), Water (Sparingly) |
| form | Powder |
| pka | 13.62±0.20(Predicted) |
| color | White to pale yellow |
| Optical Rotation | [α]23/D +43°, c = 1 in ethanol |
| Water Solubility | Slightly soluble in water. |
| BRN | 1524193 |
| InChI | InChI=1S/C4H7NO2/c6-3-1-4(7)5-2-3/h3,6H,1-2H2,(H,5,7)/t3-/m1/s1 |
| InChIKey | IOGISYQVOGVIEU-GSVOUGTGSA-N |
| SMILES | N1C[C@H](O)CC1=O |
| CAS DataBase Reference | 22677-21-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |