
22560-16-3
| Name | LITHIUM TRIETHYLBOROHYDRIDE |
| CAS | 22560-16-3 |
| EINECS(EC#) | 245-076-8 |
| Molecular Formula | C6H16BLi |
| MDL Number | MFCD00011703 |
| Molecular Weight | 105.94 |
| MOL File | 22560-16-3.mol |
Chemical Properties
| Appearance | colorless to light grey cloudy solution |
| Melting point | 66-67° (Binger); mp 78-83° (dec) (Brown, 1977) |
| density | 0.892 g/mL at 25 °C |
| Fp | 1 °F |
| storage temp. | Flammables + water-Freezer (-20°C)e area |
| solubility | Miscible with tetrahydrofuran and benzene. |
| form | Liquid |
| color | Colorless to light gray |
| Sensitive | Air & Moisture Sensitive |
| Merck | 14,5544 |
| BRN | 4151240 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | InChI=1S/C6H13B.Li/c1-4-7(5-2)6-3;/h4-7H,1-3H3;/q-1;+1 |
| InChIKey | NOLZOGXVNKCSTH-UHFFFAOYSA-N |
| SMILES | [B+3]([H-])([CH-]C)([CH-]C)[CH-]C.[Li+] |
| CAS DataBase Reference | 22560-16-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H318-H333-H225-H260-H302-H314-H335-H351 |
| Precautionary statements | P210-P231+P232-P280-P370+P378-P402+P404-P403+P235-P223-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | F,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| F | 10-23 |
| REACH Registrations | Active |
| HazardClass | 4.3 |
| PackingGroup | I |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 Water-react 1 |



