
21806-61-1
| Name | Prop-1-ene-1,3-sultone |
| CAS | 21806-61-1 |
| EINECS(EC#) | 606-834-7 |
| Molecular Formula | C3H4O3S |
| MDL Number | MFCD12405143 |
| Molecular Weight | 120.13 |
| MOL File | 21806-61-1.mol |
Chemical Properties
| Melting point | 82-83 °C |
| Boiling point | 257 °C |
| density | 1.508 |
| vapor pressure | 0.008-0.018Pa at 20-25℃ |
| Fp | 109 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Major Application | battery manufacturing |
| InChI | InChI=1S/C3H4O3S/c4-7(5)3-1-2-6-7/h1,3H,2H2 |
| InChIKey | KLLQVNFCMHPYGL-UHFFFAOYSA-N |
| SMILES | O1CC=CS1(=O)=O |
| LogP | -0.49 at 25℃ |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H341 |
| Precautionary statements | P501-P270-P202-P201-P264-P280-P308+P313-P301+P312+P330-P405 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2934.99.9001 |
| REACH Registrations | Active |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 2 Skin Sens. 1B |

