21802-37-9
| Name | CAERULOMYCIN A |
| CAS | 21802-37-9 |
| Molecular Formula | C12H11N3O2 |
| MDL Number | MFCD03093715 |
| Molecular Weight | 229.23 |
| MOL File | 21802-37-9.mol |
Chemical Properties
| Melting point | 173 °C |
| Boiling point | 420.0±45.0 °C(Predicted) |
| density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO (up to 10 mg/ml). |
| form | solid |
| pka | 9.89±0.50(Predicted) |
| color | White |
| biological source | Streptomyces caeruleus |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20° for up to 3 months. |
| InChI | 1S/C12H11N3O2/c1-17-10-6-9(8-14-16)15-12(7-10)11-4-2-3-5-13-11/h2-8,16H,1H3/b14-8+ |
| InChIKey | JCTRJRHLGOKMCF-RIYZIHGNSA-N |
| SMILES | COc1cc(\C=N\O)nc(c1)-c2ccccn2 |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |